C28H32N4O5 — CID 123611636
tert-butyl 4-[14-hydroxy-8-[(6-methoxy-3-pyridinyl)methyl]-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]butanoate (PubChem CID 123611636) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is tert-butyl 4-[14-hydroxy-8-[(6-methoxy-3-pyridinyl)methyl]-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]butanoate.
| Compound Name | tert-butyl 4-[14-hydroxy-8-[(6-methoxy-3-pyridinyl)methyl]-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]butanoate |
|---|---|
| PubChem CID | 123611636 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | tert-butyl 4-[14-hydroxy-8-[(6-methoxy-3-pyridinyl)methyl]-12-oxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-13-yl]butanoate |
| SMILES | COc1ccc(Cn2c3c(c4ccccc42)Cc2c(O)n(CCCC(=O)OC(C)(C)C)c(=O)n2C3)cn1 |
| InChI | InChI=1S/C28H32N4O5/c1-28(2,3)37-25(33)10-7-13-30-26(34)22-14-20-19-8-5-6-9-21(19)31(23(20)17-32(22)27(30)35)16-18-11-12-24(36-4)29-15-18/h5-6,8-9,11-12,15,34H,7,10,13-14,16-17H2,1-4H3 |
| InChIKey | GXZFPUVIJBBHHZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|