C35H20N2O2 — CID 123611814
N-dibenzofuran-4-yl-N-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran-9-amine (PubChem CID 123611814) has the molecular formula C35H20N2O2 and a molecular weight of 500.56 g/mol. Its IUPAC name is N-dibenzofuran-4-yl-N-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran-9-amine.
| Compound Name | N-dibenzofuran-4-yl-N-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran-9-amine |
|---|---|
| PubChem CID | 123611814 |
| Molecular Formula | C35H20N2O2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-dibenzofuran-4-yl-N-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran-9-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc3c(c2)oc2ccc4ccccc4c23)c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C35H20N2O2/c1-36-23-14-16-24(17-15-23)37(30-11-6-10-28-27-9-4-5-12-31(27)39-35(28)30)25-18-19-29-33(21-25)38-32-20-13-22-7-2-3-8-26(22)34(29)32/h2-21H |
| InChIKey | NBAQBCWZZGMYPR-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 33.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|