C26H25Cl2N5O — CID 123611987
2-N-(3-chlorophenyl)-6-[4-(3-chlorophenyl)butyl]-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 123611987) has the molecular formula C26H25Cl2N5O and a molecular weight of 494.43 g/mol. Its IUPAC name is 2-N-(3-chlorophenyl)-6-[4-(3-chlorophenyl)butyl]-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-chlorophenyl)-6-[4-(3-chlorophenyl)butyl]-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 123611987 |
| Molecular Formula | C26H25Cl2N5O |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-N-(3-chlorophenyl)-6-[4-(3-chlorophenyl)butyl]-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(CCCCc3cccc(Cl)c3)nc(Nc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C26H25Cl2N5O/c1-34-23-14-12-21(13-15-23)29-25-31-24(11-3-2-6-18-7-4-8-19(27)16-18)32-26(33-25)30-22-10-5-9-20(28)17-22/h4-5,7-10,12-17H,2-3,6,11H2,1H3,(H2,29,30,31,32,33) |
| InChIKey | LUPOWNXPHGCAAX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|