C28H23ClF3NO3 — CID 123612555
3-[3-chloro-4-(trifluoromethyl)phenyl]-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]benzoic acid (PubChem CID 123612555) has the molecular formula C28H23ClF3NO3 and a molecular weight of 513.94 g/mol. Its IUPAC name is 3-[3-chloro-4-(trifluoromethyl)phenyl]-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]benzoic acid.
| Compound Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 123612555 |
| Molecular Formula | C28H23ClF3NO3 |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]benzoic acid |
| SMILES | CC(NCCOc1cc(C(=O)O)cc(-c2ccc(C(F)(F)F)c(Cl)c2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H23ClF3NO3/c1-17(23-8-4-6-18-5-2-3-7-24(18)23)33-11-12-36-22-14-20(13-21(15-22)27(34)35)19-9-10-25(26(29)16-19)28(30,31)32/h2-10,13-17,33H,11-12H2,1H3,(H,34,35) |
| InChIKey | UIYDUVONAGJFBQ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|