C25H34O6 — CID 123612821
2-[2-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,4S)-4-methyl-3-propanoyloxynona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid (PubChem CID 123612821) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-[2-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,4S)-4-methyl-3-propanoyloxynona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,4S)-4-methyl-3-propanoyloxynona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid |
|---|---|
| PubChem CID | 123612821 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-[2-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,4S)-4-methyl-3-propanoyloxynona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetic acid |
| SMILES | CCC#CC[C@H](C)[C@@H](C#C[C@@H]1[C@H]2CC(=CCOCC(=O)O)C[C@H]2C[C@H]1O)OC(=O)CC |
| InChI | InChI=1S/C25H34O6/c1-4-6-7-8-17(3)23(31-25(29)5-2)10-9-20-21-14-18(11-12-30-16-24(27)28)13-19(21)15-22(20)26/h11,17,19-23,26H,4-5,8,12-16H2,1-3H3,(H,27,28)/t17-,19-,20+,21-,22+,23+/m0/s1 |
| InChIKey | WPTQDYPATUECCQ-CQLUJISMSA-N |
| XLogP | 3.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|