C34H43ClN4O5 — CID 123612837
ethyl 4-(3-chloro-2,3-dihydropyridin-4-yl)-4-imino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylimino]-3-[4-[(4-propan-2-ylphenyl)methoxy]phenyl]butanoate (PubChem CID 123612837) has the molecular formula C34H43ClN4O5 and a molecular weight of 623.19 g/mol. Its IUPAC name is ethyl 4-(3-chloro-2,3-dihydropyridin-4-yl)-4-imino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylimino]-3-[4-[(4-propan-2-ylphenyl)methoxy]phenyl]butanoate.
| Compound Name | ethyl 4-(3-chloro-2,3-dihydropyridin-4-yl)-4-imino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylimino]-3-[4-[(4-propan-2-ylphenyl)methoxy]phenyl]butanoate |
|---|---|
| PubChem CID | 123612837 |
| Molecular Formula | C34H43ClN4O5 |
| Molecular Weight | 623.19 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | ethyl 4-(3-chloro-2,3-dihydropyridin-4-yl)-4-imino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylimino]-3-[4-[(4-propan-2-ylphenyl)methoxy]phenyl]butanoate |
| SMILES | [H]/N=C(\C1=CC=NCC1Cl)C(/C(=N/CCNC(=O)OC(C)(C)C)C(=O)OCC)c1ccc(OCc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H43ClN4O5/c1-7-42-32(40)31(38-18-19-39-33(41)44-34(4,5)6)29(30(36)27-16-17-37-20-28(27)35)25-12-14-26(15-13-25)43-21-23-8-10-24(11-9-23)22(2)3/h8-17,22,28-29,36H,7,18-21H2,1-6H3,(H,39,41)/b36-30+,38-31- |
| InChIKey | OFLQRURXSDQSJF-DJQMUCNMSA-N |
| XLogP | 6.64 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.19 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|