C20H28N8O3 — CID 123612887
3-[[amino-(3-aminopiperidin-1-yl)methylidene]amino]-2-imino-3-[4-(morpholine-4-carbonyl)phenyl]iminopropanamide (PubChem CID 123612887) has the molecular formula C20H28N8O3 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-[[amino-(3-aminopiperidin-1-yl)methylidene]amino]-2-imino-3-[4-(morpholine-4-carbonyl)phenyl]iminopropanamide.
| Compound Name | 3-[[amino-(3-aminopiperidin-1-yl)methylidene]amino]-2-imino-3-[4-(morpholine-4-carbonyl)phenyl]iminopropanamide |
|---|---|
| PubChem CID | 123612887 |
| Molecular Formula | C20H28N8O3 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 3-[[amino-(3-aminopiperidin-1-yl)methylidene]amino]-2-imino-3-[4-(morpholine-4-carbonyl)phenyl]iminopropanamide |
| SMILES | [H]/N=C(C(N)=O)/C(=N\c1ccc(C(=O)N2CCOCC2)cc1)/N=C(\N)N1CCCC(N)C1 |
| InChI | InChI=1S/C20H28N8O3/c21-14-2-1-7-28(12-14)20(24)26-18(16(22)17(23)29)25-15-5-3-13(4-6-15)19(30)27-8-10-31-11-9-27/h3-6,14,22H,1-2,7-12,21H2,(H2,23,29)(H2,24,25,26)/b22-16+ |
| InChIKey | NFYLIBGKMOPQQF-CJLVFECKSA-N |
| XLogP | -0.57 |
| TPSA | 176.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|