C15H32N4 — CID 123612906
1-(2-methylbut-2-enyl)-1,4,8,11-tetrazacyclotetradecane (PubChem CID 123612906) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(2-methylbut-2-enyl)-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-(2-methylbut-2-enyl)-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 123612906 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 1-(2-methylbut-2-enyl)-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CC=C(C)CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C15H32N4/c1-3-15(2)14-19-12-5-8-17-10-9-16-6-4-7-18-11-13-19/h3,16-18H,4-14H2,1-2H3 |
| InChIKey | ZQAUIJYEMJXNBE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|