C16H14N9O+ — CID 123613179
8-[6-[2-(furan-2-yl)ethyl]-7H-purin-1-ium-1-yl]-7H-purin-6-amine (PubChem CID 123613179) has the molecular formula C16H14N9O+ and a molecular weight of 348.35 g/mol. Its IUPAC name is 8-[6-[2-(furan-2-yl)ethyl]-7H-purin-1-ium-1-yl]-7H-purin-6-amine.
| Compound Name | 8-[6-[2-(furan-2-yl)ethyl]-7H-purin-1-ium-1-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 123613179 |
| Molecular Formula | C16H14N9O+ |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 8-[6-[2-(furan-2-yl)ethyl]-7H-purin-1-ium-1-yl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(-[n+]3cnc4nc[nH]c4c3CCc3ccco3)[nH]c12 |
| InChI | InChI=1S/C16H13N9O/c17-13-12-15(21-7-19-13)24-16(23-12)25-8-22-14-11(18-6-20-14)10(25)4-3-9-2-1-5-26-9/h1-2,5-8H,3-4H2,(H3,17,19,21,23,24)/p+1 |
| InChIKey | OSLCGBOVPYWAKB-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 139.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|