C9H7F3N2O — CID 123613376
3-hexa-1,3,5-trien-3-yl-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 123613376) has the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. Its IUPAC name is 3-hexa-1,3,5-trien-3-yl-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-hexa-1,3,5-trien-3-yl-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123613376 |
| Molecular Formula | C9H7F3N2O |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-hexa-1,3,5-trien-3-yl-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | C=CC=C(C=C)c1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H7F3N2O/c1-3-5-6(4-2)7-13-8(15-14-7)9(10,11)12/h3-5H,1-2H2 |
| InChIKey | HSZWJWONCCAUMZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|