C19H37+ — CID 123613577
1,1,6-trimethyl-3-(4-methylheptan-2-yl)cyclooctane (PubChem CID 123613577) has the molecular formula C19H37+ and a molecular weight of 265.50 g/mol. Its IUPAC name is 1,1,6-trimethyl-3-(4-methylheptan-2-yl)cyclooctane.
| Compound Name | 1,1,6-trimethyl-3-(4-methylheptan-2-yl)cyclooctane |
|---|---|
| PubChem CID | 123613577 |
| Molecular Formula | C19H37+ |
| Molecular Weight | 265.50 g/mol |
| Exact Mass | 265.29 |
| IUPAC Name | 1,1,6-trimethyl-3-(4-methylheptan-2-yl)cyclooctane |
| SMILES | C[CH+]CC(C)CC(C)C1CCC(C)CCC(C)(C)C1 |
| InChI | InChI=1S/C19H37/c1-7-8-16(3)13-17(4)18-10-9-15(2)11-12-19(5,6)14-18/h7,15-18H,8-14H2,1-6H3/q+1 |
| InChIKey | JLJQBBAUPVIOLW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|