About N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine
N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine (PubChem CID 123613672) has the molecular formula C14H30FN3
and a molecular weight of 259.41 g/mol. Its IUPAC name is N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine |
| PubChem CID | 123613672 |
| Molecular Formula | C14H30FN3 |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.24 |
| IUPAC Name | N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine |
| SMILES | C=C(F)C(C)C(C)C(CCC)NCN(C)CNC |
| InChI | InChI=1S/C14H30FN3/c1-7-8-14(12(3)11(2)13(4)15)17-10-18(6)9-16-5/h11-12,14,16-17H,4,7-10H2,1-3,5-6H3 |
| InChIKey | JDZYOGVOSILVCP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine?
The IUPAC name of N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine (CID 123613672) is N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine.
What is the SMILES notation for N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine?
The canonical SMILES for N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine is C=C(F)C(C)C(C)C(CCC)NCN(C)CNC.
What is the InChIKey of N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine?
The InChIKey is JDZYOGVOSILVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30FN3/c1-7-8-14(12(3)11(2)13(4)15)17-10-18(6)9-16-5/h11-12,14,16-17H,4,7-10H2,1-3,5-6H3.
What are the key properties of N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine?
N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine has a molecular weight of 259.41 g/mol, XLogP of 2.57, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[(7-fluoro-5,6-dimethyloct-7-en-4-yl)amino]methyl]-N,N'-dimethylmethanediamine is sourced from PubChem (CID 123613672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).