C46H30BBrN2O4 — CID 123613990
[3-benzoyl-11-(4-bromophenyl)-5-[4-(1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazol-9-yl]-phenylmethanone (PubChem CID 123613990) has the molecular formula C46H30BBrN2O4 and a molecular weight of 765.47 g/mol. Its IUPAC name is [3-benzoyl-11-(4-bromophenyl)-5-[4-(1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazol-9-yl]-phenylmethanone.
| Compound Name | [3-benzoyl-11-(4-bromophenyl)-5-[4-(1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazol-9-yl]-phenylmethanone |
|---|---|
| PubChem CID | 123613990 |
| Molecular Formula | C46H30BBrN2O4 |
| Molecular Weight | 765.47 g/mol |
| Exact Mass | 764.15 |
| IUPAC Name | [3-benzoyl-11-(4-bromophenyl)-5-[4-(1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazol-9-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc2c3cc4c(cc3n(-c3ccc(Br)cc3)c2c1)c1ccc(C(=O)c2ccccc2)cc1n4-c1ccc(B2OCCO2)cc1 |
| InChI | InChI=1S/C46H30BBrN2O4/c48-34-15-19-36(20-16-34)50-42-26-32(46(52)30-9-5-2-6-10-30)12-22-38(42)40-27-43-39(28-44(40)50)37-21-11-31(45(51)29-7-3-1-4-8-29)25-41(37)49(43)35-17-13-33(14-18-35)47-53-23-24-54-47/h1-22,25-28H,23-24H2 |
| InChIKey | FWWFHIGONRSGOV-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.47 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|