C20H24O3 — CID 123614198
16-hydroxy-11-methyltetracyclo[12.4.1.02,7.08,13]nonadeca-5,8(13),17-triene-4,10-dione (PubChem CID 123614198) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 16-hydroxy-11-methyltetracyclo[12.4.1.02,7.08,13]nonadeca-5,8(13),17-triene-4,10-dione.
| Compound Name | 16-hydroxy-11-methyltetracyclo[12.4.1.02,7.08,13]nonadeca-5,8(13),17-triene-4,10-dione |
|---|---|
| PubChem CID | 123614198 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 16-hydroxy-11-methyltetracyclo[12.4.1.02,7.08,13]nonadeca-5,8(13),17-triene-4,10-dione |
| SMILES | CC1CC2=C(CC1=O)C1C=CC(=O)CC1C1C=CC(O)CC2C1 |
| InChI | InChI=1S/C20H24O3/c1-11-6-17-13-7-12(2-3-14(21)8-13)18-9-15(22)4-5-16(18)19(17)10-20(11)23/h2-5,11-14,16,18,21H,6-10H2,1H3 |
| InChIKey | XVZMGOKBPLBSIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|