C23H24N4OS — CID 123614331
4-methyl-5-[(7E)-2-methyl-7-(oxiran-2-ylmethylidene)-6,8,9,10-tetrahydro-1H-1,6-benzodiazocin-5-yl]-2-pyridin-3-yl-1,3-thiazole (PubChem CID 123614331) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-methyl-5-[(7E)-2-methyl-7-(oxiran-2-ylmethylidene)-6,8,9,10-tetrahydro-1H-1,6-benzodiazocin-5-yl]-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 4-methyl-5-[(7E)-2-methyl-7-(oxiran-2-ylmethylidene)-6,8,9,10-tetrahydro-1H-1,6-benzodiazocin-5-yl]-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 123614331 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-methyl-5-[(7E)-2-methyl-7-(oxiran-2-ylmethylidene)-6,8,9,10-tetrahydro-1H-1,6-benzodiazocin-5-yl]-2-pyridin-3-yl-1,3-thiazole |
| SMILES | Cc1ccc(-c2sc(-c3cccnc3)nc2C)[nH]c2c([nH]1)CCC/C2=C\C1CO1 |
| InChI | InChI=1S/C23H24N4OS/c1-14-8-9-20(22-15(2)26-23(29-22)17-6-4-10-24-12-17)27-21-16(11-18-13-28-18)5-3-7-19(21)25-14/h4,6,8-12,18,25,27H,3,5,7,13H2,1-2H3/b14-8-,16-11+,20-9- |
| InChIKey | FZWQAIURHUISEM-KURCFMEISA-N |
| XLogP | 5.39 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|