About 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole
1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole (PubChem CID 123614453) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole.
Molecular Properties
| Compound Name | 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole |
| PubChem CID | 123614453 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole |
| SMILES | CCCCC(=CC=C(C)C)c1cn(C)nc1C |
| InChI | InChI=1S/C15H24N2/c1-6-7-8-14(10-9-12(2)3)15-11-17(5)16-13(15)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | ACDJUYOTIWOSBB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole?
The IUPAC name of 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole (CID 123614453) is 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole.
What is the SMILES notation for 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole?
The canonical SMILES for 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole is CCCCC(=CC=C(C)C)c1cn(C)nc1C.
What is the InChIKey of 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole?
The InChIKey is ACDJUYOTIWOSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-6-7-8-14(10-9-12(2)3)15-11-17(5)16-13(15)4/h9-11H,6-8H2,1-5H3.
What are the key properties of 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole?
1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole has a molecular weight of 232.37 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4-(2-methylnona-2,4-dien-5-yl)pyrazole is sourced from PubChem (CID 123614453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).