About 3-methyldec-1-en-5-imine
3-methyldec-1-en-5-imine (PubChem CID 123614740) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 3-methyldec-1-en-5-imine.
Molecular Properties
| Compound Name | 3-methyldec-1-en-5-imine |
| PubChem CID | 123614740 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3-methyldec-1-en-5-imine |
| SMILES | [H]/N=C(\CCCCC)CC(C)C=C |
| InChI | InChI=1S/C11H21N/c1-4-6-7-8-11(12)9-10(3)5-2/h5,10,12H,2,4,6-9H2,1,3H3/b12-11+ |
| InChIKey | DLXFBXRWTXPLCO-VAWYXSNFSA-N |
| XLogP | 3.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyldec-1-en-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyldec-1-en-5-imine?
The IUPAC name of 3-methyldec-1-en-5-imine (CID 123614740) is 3-methyldec-1-en-5-imine.
What is the SMILES notation for 3-methyldec-1-en-5-imine?
The canonical SMILES for 3-methyldec-1-en-5-imine is [H]/N=C(\CCCCC)CC(C)C=C.
What is the InChIKey of 3-methyldec-1-en-5-imine?
The InChIKey is DLXFBXRWTXPLCO-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H21N/c1-4-6-7-8-11(12)9-10(3)5-2/h5,10,12H,2,4,6-9H2,1,3H3/b12-11+.
What are the key properties of 3-methyldec-1-en-5-imine?
3-methyldec-1-en-5-imine has a molecular weight of 167.30 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyldec-1-en-5-imine is sourced from PubChem (CID 123614740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).