C40H45FN2+2 — CID 123615563
13,14-diethyl-12-(3-fluoroprop-2-enylidene)-9,9,13-trimethyl-14-[3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]propyl]-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,10-hexaene (PubChem CID 123615563) has the molecular formula C40H45FN2+2 and a molecular weight of 572.81 g/mol. Its IUPAC name is 13,14-diethyl-12-(3-fluoroprop-2-enylidene)-9,9,13-trimethyl-14-[3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]propyl]-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,10-hexaene.
| Compound Name | 13,14-diethyl-12-(3-fluoroprop-2-enylidene)-9,9,13-trimethyl-14-[3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]propyl]-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,10-hexaene |
|---|---|
| PubChem CID | 123615563 |
| Molecular Formula | C40H45FN2+2 |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | 13,14-diethyl-12-(3-fluoroprop-2-enylidene)-9,9,13-trimethyl-14-[3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]propyl]-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,10-hexaene |
| SMILES | CCC1(C)C(=CC=CF)C2=CC(C)(C)c3cccc4cc[n+](c2c34)C1(CC)CCC[n+]1ccccc1-c1ccccc1C |
| InChI | InChI=1S/C40H45FN2/c1-7-39(6)33(20-14-24-41)32-28-38(4,5)34-19-13-17-30-22-27-43(37(32)36(30)34)40(39,8-2)23-15-26-42-25-12-11-21-35(42)31-18-10-9-16-29(31)3/h9-14,16-22,24-25,27-28H,7-8,15,23,26H2,1-6H3/q+2 |
| InChIKey | USGLHMGLVRPSEU-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|