C24H32N2O4 — CID 123615842
2-methyl-N-[7-oxo-1-(5-phenyl-1,3-oxazol-2-yl)nonyl]oxolane-2-carboxamide (PubChem CID 123615842) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-methyl-N-[7-oxo-1-(5-phenyl-1,3-oxazol-2-yl)nonyl]oxolane-2-carboxamide.
| Compound Name | 2-methyl-N-[7-oxo-1-(5-phenyl-1,3-oxazol-2-yl)nonyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 123615842 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-methyl-N-[7-oxo-1-(5-phenyl-1,3-oxazol-2-yl)nonyl]oxolane-2-carboxamide |
| SMILES | CCC(=O)CCCCCC(NC(=O)C1(C)CCCO1)c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H32N2O4/c1-3-19(27)13-8-5-9-14-20(26-23(28)24(2)15-10-16-29-24)22-25-17-21(30-22)18-11-6-4-7-12-18/h4,6-7,11-12,17,20H,3,5,8-10,13-16H2,1-2H3,(H,26,28) |
| InChIKey | VDYAEXPFNQETBU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|