C12H19N5O2 — CID 123616116
2-[N'-[2-(3,4-dihydroxyphenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine (PubChem CID 123616116) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[N'-[2-(3,4-dihydroxyphenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine.
| Compound Name | 2-[N'-[2-(3,4-dihydroxyphenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 123616116 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[N'-[2-(3,4-dihydroxyphenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine |
| SMILES | CN(C)C(N)=N/C(N)=N/CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H19N5O2/c1-17(2)12(14)16-11(13)15-6-5-8-3-4-9(18)10(19)7-8/h3-4,7,18-19H,5-6H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | HRSWLQUBZFBZEM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|