About 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one
5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one (PubChem CID 123616215) has the molecular formula C17H23NO6S
and a molecular weight of 369.44 g/mol. Its IUPAC name is 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one |
| PubChem CID | 123616215 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one |
| SMILES | C=CC(=CC=CC)CS(=O)(=O)c1cc(OCOC)c(=O)n(COC)c1 |
| InChI | InChI=1S/C17H23NO6S/c1-5-7-8-14(6-2)11-25(20,21)15-9-16(24-13-23-4)17(19)18(10-15)12-22-3/h5-10H,2,11-13H2,1,3-4H3 |
| InChIKey | PPOCLXZHUZYPTD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one?
The IUPAC name of 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one (CID 123616215) is 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one.
What is the SMILES notation for 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one?
The canonical SMILES for 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one is C=CC(=CC=CC)CS(=O)(=O)c1cc(OCOC)c(=O)n(COC)c1.
What is the InChIKey of 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one?
The InChIKey is PPOCLXZHUZYPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO6S/c1-5-7-8-14(6-2)11-25(20,21)15-9-16(24-13-23-4)17(19)18(10-15)12-22-3/h5-10H,2,11-13H2,1,3-4H3.
What are the key properties of 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one?
5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one has a molecular weight of 369.44 g/mol, XLogP of 1.90, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethenylhexa-2,4-dienylsulfonyl)-3-(methoxymethoxy)-1-(methoxymethyl)pyridin-2-one is sourced from PubChem (CID 123616215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).