C22H33NO — CID 123616468
1-ethyl-6,10a,12a-trimethyl-3,3a,3b,4,8,9,10,10b,11,12-decahydroindeno[5,4-g][1]benzazepin-7-one (PubChem CID 123616468) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is 1-ethyl-6,10a,12a-trimethyl-3,3a,3b,4,8,9,10,10b,11,12-decahydroindeno[5,4-g][1]benzazepin-7-one.
| Compound Name | 1-ethyl-6,10a,12a-trimethyl-3,3a,3b,4,8,9,10,10b,11,12-decahydroindeno[5,4-g][1]benzazepin-7-one |
|---|---|
| PubChem CID | 123616468 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 1-ethyl-6,10a,12a-trimethyl-3,3a,3b,4,8,9,10,10b,11,12-decahydroindeno[5,4-g][1]benzazepin-7-one |
| SMILES | CCC1=CCC2C3CC=C4N(C)C(=O)CCCC4(C)C3CCC12C |
| InChI | InChI=1S/C22H33NO/c1-5-15-8-10-17-16-9-11-19-22(3,13-6-7-20(24)23(19)4)18(16)12-14-21(15,17)2/h8,11,16-18H,5-7,9-10,12-14H2,1-4H3 |
| InChIKey | FREXIYKJJSCAIK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|