About N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide
N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide (PubChem CID 123616674) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide |
| PubChem CID | 123616674 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide |
| SMILES | CC=C/C(=N\C)NCCN(C)CCCC |
| InChI | InChI=1S/C12H25N3/c1-5-7-10-15(4)11-9-14-12(13-3)8-6-2/h6,8H,5,7,9-11H2,1-4H3,(H,13,14) |
| InChIKey | VNGOPLSZVLZAOF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide?
The IUPAC name of N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide (CID 123616674) is N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide.
What is the SMILES notation for N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide?
The canonical SMILES for N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide is CC=C/C(=N\C)NCCN(C)CCCC.
What is the InChIKey of N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide?
The InChIKey is VNGOPLSZVLZAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-5-7-10-15(4)11-9-14-12(13-3)8-6-2/h6,8H,5,7,9-11H2,1-4H3,(H,13,14).
What are the key properties of N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide?
N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide has a molecular weight of 211.35 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[butyl(methyl)amino]ethyl]-N'-methylbut-2-enimidamide is sourced from PubChem (CID 123616674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).