About 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane
1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane (PubChem CID 123616898) has the molecular formula C23H46
and a molecular weight of 322.62 g/mol. Its IUPAC name is 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane.
Molecular Properties
| Compound Name | 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane |
| PubChem CID | 123616898 |
| Molecular Formula | C23H46 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane |
| SMILES | CCCC1CC1C(C(C)CCCCC(C)C)C(CC)C(C)CC |
| InChI | InChI=1S/C23H46/c1-8-13-20-16-22(20)23(21(10-3)18(6)9-2)19(7)15-12-11-14-17(4)5/h17-23H,8-16H2,1-7H3 |
| InChIKey | HSHAUBKMMAKEIT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane?
The IUPAC name of 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane (CID 123616898) is 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane.
What is the SMILES notation for 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane?
The canonical SMILES for 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane is CCCC1CC1C(C(C)CCCCC(C)C)C(CC)C(C)CC.
What is the InChIKey of 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane?
The InChIKey is HSHAUBKMMAKEIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46/c1-8-13-20-16-22(20)23(21(10-3)18(6)9-2)19(7)15-12-11-14-17(4)5/h17-23H,8-16H2,1-7H3.
What are the key properties of 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane?
1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane has a molecular weight of 322.62 g/mol, XLogP of 7.96, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-3,6,11-trimethyldodecan-5-yl)-2-propylcyclopropane is sourced from PubChem (CID 123616898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).