C25H35N3O2S — CID 123616971
(6-methylidene-5H-1,3-benzodioxol-5-yl) 3-ethyl-N-(3-ethyl-5-imino-7-methyl-3,4-dihydroazepin-6-yl)hexanimidothioate (PubChem CID 123616971) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is (6-methylidene-5H-1,3-benzodioxol-5-yl) 3-ethyl-N-(3-ethyl-5-imino-7-methyl-3,4-dihydroazepin-6-yl)hexanimidothioate.
| Compound Name | (6-methylidene-5H-1,3-benzodioxol-5-yl) 3-ethyl-N-(3-ethyl-5-imino-7-methyl-3,4-dihydroazepin-6-yl)hexanimidothioate |
|---|---|
| PubChem CID | 123616971 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (6-methylidene-5H-1,3-benzodioxol-5-yl) 3-ethyl-N-(3-ethyl-5-imino-7-methyl-3,4-dihydroazepin-6-yl)hexanimidothioate |
| SMILES | [H]/N=C1\CC(CC)C=NC(C)=C1/N=C(\CC(CC)CCC)SC1C=C2OCOC2=CC1=C |
| InChI | InChI=1S/C25H35N3O2S/c1-6-9-18(7-2)12-24(28-25-17(5)27-14-19(8-3)11-20(25)26)31-23-13-22-21(10-16(23)4)29-15-30-22/h10,13-14,18-19,23,26H,4,6-9,11-12,15H2,1-3,5H3/b26-20+,28-24+ |
| InChIKey | YJCALAZAYJJXMZ-RPZMVSOASA-N |
| XLogP | 6.80 |
| TPSA | 67.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|