C42H64O2 — CID 123617021
2-(3,7,8,8-tetramethylnonan-3-yl)-6-(4,8,9,9-tetramethylundecan-4-yl)anthracene-9,10-dione (PubChem CID 123617021) has the molecular formula C42H64O2 and a molecular weight of 600.97 g/mol. Its IUPAC name is 2-(3,7,8,8-tetramethylnonan-3-yl)-6-(4,8,9,9-tetramethylundecan-4-yl)anthracene-9,10-dione.
| Compound Name | 2-(3,7,8,8-tetramethylnonan-3-yl)-6-(4,8,9,9-tetramethylundecan-4-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 123617021 |
| Molecular Formula | C42H64O2 |
| Molecular Weight | 600.97 g/mol |
| Exact Mass | 600.49 |
| IUPAC Name | 2-(3,7,8,8-tetramethylnonan-3-yl)-6-(4,8,9,9-tetramethylundecan-4-yl)anthracene-9,10-dione |
| SMILES | CCCC(C)(CCCC(C)C(C)(C)CC)c1ccc2c(c1)C(=O)c1ccc(C(C)(CC)CCCC(C)C(C)(C)C)cc1C2=O |
| InChI | InChI=1S/C42H64O2/c1-13-24-42(12,26-17-19-30(5)40(9,10)14-2)32-21-23-34-36(28-32)38(44)33-22-20-31(27-35(33)37(34)43)41(11,15-3)25-16-18-29(4)39(6,7)8/h20-23,27-30H,13-19,24-26H2,1-12H3 |
| InChIKey | NCQCOOIRSKDZDD-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.97 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|