C7H10N4 — CID 123617120
N-(5-methyl-2-prop-1-enyl-1,2,4-triazol-3-yl)methanimine (PubChem CID 123617120) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is N-(5-methyl-2-prop-1-enyl-1,2,4-triazol-3-yl)methanimine.
| Compound Name | N-(5-methyl-2-prop-1-enyl-1,2,4-triazol-3-yl)methanimine |
|---|---|
| PubChem CID | 123617120 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N-(5-methyl-2-prop-1-enyl-1,2,4-triazol-3-yl)methanimine |
| SMILES | C=Nc1nc(C)nn1C=CC |
| InChI | InChI=1S/C7H10N4/c1-4-5-11-7(8-3)9-6(2)10-11/h4-5H,3H2,1-2H3 |
| InChIKey | SOFZTXIRYMKXKE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|