C50H39N7O2 — CID 123617430
4-[10-[4-(3-aminopropoxy)phenyl]-15-(4-cyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile (PubChem CID 123617430) has the molecular formula C50H39N7O2 and a molecular weight of 769.91 g/mol. Its IUPAC name is 4-[10-[4-(3-aminopropoxy)phenyl]-15-(4-cyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile.
| Compound Name | 4-[10-[4-(3-aminopropoxy)phenyl]-15-(4-cyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 123617430 |
| Molecular Formula | C50H39N7O2 |
| Molecular Weight | 769.91 g/mol |
| Exact Mass | 769.32 |
| IUPAC Name | 4-[10-[4-(3-aminopropoxy)phenyl]-15-(4-cyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile |
| SMILES | COc1ccc(C2=c3ccc([nH]3)=C(c3ccc(C#N)cc3)c3ccc([nH]3)C(c3ccc(OCCCN)cc3)=c3ccc([nH]3)=C(c3ccc(C#N)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C50H39N7O2/c1-58-37-15-11-35(12-16-37)49-43-23-19-39(54-43)47(33-7-3-31(29-52)4-8-33)41-21-25-45(56-41)50(36-13-17-38(18-14-36)59-28-2-27-51)46-26-22-42(57-46)48(40-20-24-44(49)55-40)34-9-5-32(30-53)6-10-34/h3-26,54-57H,2,27-28,51H2,1H3 |
| InChIKey | FARXWOIPRKWHAV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 155.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|