C33H41NO2 — CID 123618324
N-[5-(5-ethylideneoct-7-enoyl)-2-[4-(2-methylphenyl)cyclohexyl]phenyl]cyclopropanecarboxamide (PubChem CID 123618324) has the molecular formula C33H41NO2 and a molecular weight of 483.70 g/mol. Its IUPAC name is N-[5-(5-ethylideneoct-7-enoyl)-2-[4-(2-methylphenyl)cyclohexyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[5-(5-ethylideneoct-7-enoyl)-2-[4-(2-methylphenyl)cyclohexyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 123618324 |
| Molecular Formula | C33H41NO2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | N-[5-(5-ethylideneoct-7-enoyl)-2-[4-(2-methylphenyl)cyclohexyl]phenyl]cyclopropanecarboxamide |
| SMILES | C=CCC(=CC)CCCC(=O)c1ccc(C2CCC(c3ccccc3C)CC2)c(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C33H41NO2/c1-4-9-24(5-2)11-8-13-32(35)28-20-21-30(31(22-28)34-33(36)27-18-19-27)26-16-14-25(15-17-26)29-12-7-6-10-23(29)3/h4-7,10,12,20-22,25-27H,1,8-9,11,13-19H2,2-3H3,(H,34,36) |
| InChIKey | ZFRSPSYQUAVQEO-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|