C23H22F8O — CID 123618433
1-[2-(4-ethylcyclohexyl)ethyl]-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene (PubChem CID 123618433) has the molecular formula C23H22F8O and a molecular weight of 466.41 g/mol. Its IUPAC name is 1-[2-(4-ethylcyclohexyl)ethyl]-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene.
| Compound Name | 1-[2-(4-ethylcyclohexyl)ethyl]-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 123618433 |
| Molecular Formula | C23H22F8O |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-[2-(4-ethylcyclohexyl)ethyl]-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)benzene |
| SMILES | CCC1CCC(CCc2c(F)c(F)c(-c3c(F)c(F)c(OC)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C23H22F8O/c1-3-10-4-6-11(7-5-10)8-9-12-15(24)17(26)13(18(27)16(12)25)14-19(28)21(30)23(32-2)22(31)20(14)29/h10-11H,3-9H2,1-2H3 |
| InChIKey | ZTNXDXFSQJMVBP-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|