C14H26O2Si — CID 123619096
2,2,6,6-tetramethyl-4-(2-trimethylsilylethynyl)oxan-4-ol (PubChem CID 123619096) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(2-trimethylsilylethynyl)oxan-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-4-(2-trimethylsilylethynyl)oxan-4-ol |
|---|---|
| PubChem CID | 123619096 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(2-trimethylsilylethynyl)oxan-4-ol |
| SMILES | CC1(C)CC(O)(C#C[Si](C)(C)C)CC(C)(C)O1 |
| InChI | InChI=1S/C14H26O2Si/c1-12(2)10-14(15,8-9-17(5,6)7)11-13(3,4)16-12/h15H,10-11H2,1-7H3 |
| InChIKey | JKENALMUEBYHPN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|