C21H25F2N3O4 — CID 123619590
1-(2,2-difluoroethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 123619590) has the molecular formula C21H25F2N3O4 and a molecular weight of 421.44 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1-(2,2-difluoroethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 123619590 |
| Molecular Formula | C21H25F2N3O4 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-(2,2-difluoroethyl)-7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(O)cc1C12CC3CN(CC(F)F)C3C1(O)CCC1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H25F2N3O4/c1-11-2-3-13(27)6-14(11)19-7-12-8-26(9-15(22)23)16(12)21(19,30)5-4-20(10-19)17(28)24-18(29)25-20/h2-3,6,12,15-16,27,30H,4-5,7-10H2,1H3,(H2,24,25,28,29) |
| InChIKey | XQQXFMHDCCMAMQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|