C12H10N4O3 — CID 123619682
6-ethoxy-2H-[1,2,4]triazino[4,3-c]quinazoline-3,4-dione (PubChem CID 123619682) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 6-ethoxy-2H-[1,2,4]triazino[4,3-c]quinazoline-3,4-dione.
| Compound Name | 6-ethoxy-2H-[1,2,4]triazino[4,3-c]quinazoline-3,4-dione |
|---|---|
| PubChem CID | 123619682 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 6-ethoxy-2H-[1,2,4]triazino[4,3-c]quinazoline-3,4-dione |
| SMILES | CCOc1nc2ccccc2c2n[nH]c(=O)c(=O)n12 |
| InChI | InChI=1S/C12H10N4O3/c1-2-19-12-13-8-6-4-3-5-7(8)9-14-15-10(17)11(18)16(9)12/h3-6H,2H2,1H3,(H,15,17) |
| InChIKey | DXCTYJJYRKWPEO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|