About 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide
2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide (PubChem CID 123619975) has the molecular formula C7H11F3N4
and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide.
Molecular Properties
| Compound Name | 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide |
| PubChem CID | 123619975 |
| Molecular Formula | C7H11F3N4 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide |
| SMILES | [H]/N=C(N)/C(N)=N/C=CC(C)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N4/c1-4(7(8,9)10)2-3-14-6(13)5(11)12/h2-4H,1H3,(H3,11,12)(H2,13,14) |
| InChIKey | TUUWQNDWRRVDKT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide?
The IUPAC name of 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide (CID 123619975) is 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide.
What is the SMILES notation for 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide?
The canonical SMILES for 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide is [H]/N=C(N)/C(N)=N/C=CC(C)C(F)(F)F.
What is the InChIKey of 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide?
The InChIKey is TUUWQNDWRRVDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N4/c1-4(7(8,9)10)2-3-14-6(13)5(11)12/h2-4H,1H3,(H3,11,12)(H2,13,14).
What are the key properties of 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide?
2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide has a molecular weight of 208.19 g/mol, XLogP of 0.99, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N'-(4,4,4-trifluoro-3-methylbut-1-enyl)ethanediimidamide is sourced from PubChem (CID 123619975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).