About 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane
3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane (PubChem CID 123620205) has the molecular formula C20H38O4Si2
and a molecular weight of 398.69 g/mol. Its IUPAC name is 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane.
Molecular Properties
| Compound Name | 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane |
| PubChem CID | 123620205 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane |
| SMILES | CCOC(CC[SiH2]c1ccc([SiH2]CCC(OCC)OCC)cc1)OCC |
| InChI | InChI=1S/C20H38O4Si2/c1-5-21-19(22-6-2)13-15-25-17-9-11-18(12-10-17)26-16-14-20(23-7-3)24-8-4/h9-12,19-20H,5-8,13-16,25-26H2,1-4H3 |
| InChIKey | WQXJKCBKBWHRKS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane?
The IUPAC name of 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane (CID 123620205) is 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane.
What is the SMILES notation for 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane?
The canonical SMILES for 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane is CCOC(CC[SiH2]c1ccc([SiH2]CCC(OCC)OCC)cc1)OCC.
What is the InChIKey of 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane?
The InChIKey is WQXJKCBKBWHRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O4Si2/c1-5-21-19(22-6-2)13-15-25-17-9-11-18(12-10-17)26-16-14-20(23-7-3)24-8-4/h9-12,19-20H,5-8,13-16,25-26H2,1-4H3.
What are the key properties of 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane?
3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane has a molecular weight of 398.69 g/mol, XLogP of 1.69, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxypropyl-[4-(3,3-diethoxypropylsilyl)phenyl]silane is sourced from PubChem (CID 123620205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).