C15H19N3O2 — CID 123620269
4-methyl-2-(2-morpholin-4-ylethyl)-2,7-naphthyridin-1-one (PubChem CID 123620269) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-methyl-2-(2-morpholin-4-ylethyl)-2,7-naphthyridin-1-one.
| Compound Name | 4-methyl-2-(2-morpholin-4-ylethyl)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 123620269 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-methyl-2-(2-morpholin-4-ylethyl)-2,7-naphthyridin-1-one |
| SMILES | Cc1cn(CCN2CCOCC2)c(=O)c2cnccc12 |
| InChI | InChI=1S/C15H19N3O2/c1-12-11-18(5-4-17-6-8-20-9-7-17)15(19)14-10-16-3-2-13(12)14/h2-3,10-11H,4-9H2,1H3 |
| InChIKey | SMSBKLQDOQJNLL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |