C15H30 — CID 123620365
5,5-diethyl-6,6,7-trimethyloct-2-ene (PubChem CID 123620365) has the molecular formula C15H30 and a molecular weight of 210.41 g/mol. Its IUPAC name is 5,5-diethyl-6,6,7-trimethyloct-2-ene.
| Compound Name | 5,5-diethyl-6,6,7-trimethyloct-2-ene |
|---|---|
| PubChem CID | 123620365 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.41 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 5,5-diethyl-6,6,7-trimethyloct-2-ene |
| SMILES | CC=CCC(CC)(CC)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H30/c1-8-11-12-15(9-2,10-3)14(6,7)13(4)5/h8,11,13H,9-10,12H2,1-7H3 |
| InChIKey | ZIXHDIXYYCBKJD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|