C37H40N4O2S2 — CID 123620722
2-[5-[2-[3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,1,2-trimethylbenzo[e]indol-6-yl)acetamide (PubChem CID 123620722) has the molecular formula C37H40N4O2S2 and a molecular weight of 636.89 g/mol. Its IUPAC name is 2-[5-[2-[3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,1,2-trimethylbenzo[e]indol-6-yl)acetamide.
| Compound Name | 2-[5-[2-[3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,1,2-trimethylbenzo[e]indol-6-yl)acetamide |
|---|---|
| PubChem CID | 123620722 |
| Molecular Formula | C37H40N4O2S2 |
| Molecular Weight | 636.89 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | 2-[5-[2-[3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,1,2-trimethylbenzo[e]indol-6-yl)acetamide |
| SMILES | CC1=Nc2ccc3c(NC(=O)CN4C(=O)C(=CC=C5N(CCC(C)C)c6ccccc6C5(C)C)SC4=S)cccc3c2C1(C)C |
| InChI | InChI=1S/C37H40N4O2S2/c1-22(2)19-20-40-29-14-9-8-12-26(29)37(6,7)31(40)18-17-30-34(43)41(35(44)45-30)21-32(42)39-27-13-10-11-25-24(27)15-16-28-33(25)36(4,5)23(3)38-28/h8-18,22H,19-21H2,1-7H3,(H,39,42) |
| InChIKey | ZILFHTPKYVPUIU-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.89 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|