About 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one
6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one (PubChem CID 123620960) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one |
| PubChem CID | 123620960 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one |
| SMILES | CCc1ncc(=O)[nH]c1/C(C)=N/C |
| InChI | InChI=1S/C9H13N3O/c1-4-7-9(6(2)10-3)12-8(13)5-11-7/h5H,4H2,1-3H3,(H,12,13)/b10-6+ |
| InChIKey | FMHROWVHBFQCGD-UXBLZVDNSA-N |
| XLogP | 0.77 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one?
The IUPAC name of 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one (CID 123620960) is 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one.
What is the SMILES notation for 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one?
The canonical SMILES for 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one is CCc1ncc(=O)[nH]c1/C(C)=N/C.
What is the InChIKey of 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one?
The InChIKey is FMHROWVHBFQCGD-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H13N3O/c1-4-7-9(6(2)10-3)12-8(13)5-11-7/h5H,4H2,1-3H3,(H,12,13)/b10-6+.
What are the key properties of 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one?
6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one has a molecular weight of 179.22 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(C,N-dimethylcarbonimidoyl)-5-ethyl-1H-pyrazin-2-one is sourced from PubChem (CID 123620960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).