C21H12Cl2F5N5 — CID 123621022
8-(2,5-dichlorophenyl)-2-[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]-6-(trifluoromethyl)-7H-purine (PubChem CID 123621022) has the molecular formula C21H12Cl2F5N5 and a molecular weight of 500.26 g/mol. Its IUPAC name is 8-(2,5-dichlorophenyl)-2-[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]-6-(trifluoromethyl)-7H-purine.
| Compound Name | 8-(2,5-dichlorophenyl)-2-[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]-6-(trifluoromethyl)-7H-purine |
|---|---|
| PubChem CID | 123621022 |
| Molecular Formula | C21H12Cl2F5N5 |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 8-(2,5-dichlorophenyl)-2-[6-(1,1-difluorobut-3-enyl)-3-pyridinyl]-6-(trifluoromethyl)-7H-purine |
| SMILES | C=CCC(F)(F)c1ccc(-c2nc(C(F)(F)F)c3[nH]c(-c4cc(Cl)ccc4Cl)nc3n2)cn1 |
| InChI | InChI=1S/C21H12Cl2F5N5/c1-2-7-20(24,25)14-6-3-10(9-29-14)17-31-16(21(26,27)28)15-19(32-17)33-18(30-15)12-8-11(22)4-5-13(12)23/h2-6,8-9H,1,7H2,(H,30,31,32,33) |
| InChIKey | IYUVMVPBRKTSSL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|