About N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine
N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine (PubChem CID 123621328) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine.
Molecular Properties
| Compound Name | N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine |
| PubChem CID | 123621328 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine |
| SMILES | C/N=C(\C)CCc1ncns1 |
| InChI | InChI=1S/C7H11N3S/c1-6(8-2)3-4-7-9-5-10-11-7/h5H,3-4H2,1-2H3/b8-6+ |
| InChIKey | GEZSXRWPMQTUQK-SOFGYWHQSA-N |
| XLogP | 1.56 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine?
The IUPAC name of N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine (CID 123621328) is N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine.
What is the SMILES notation for N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine?
The canonical SMILES for N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine is C/N=C(\C)CCc1ncns1.
What is the InChIKey of N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine?
The InChIKey is GEZSXRWPMQTUQK-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H11N3S/c1-6(8-2)3-4-7-9-5-10-11-7/h5H,3-4H2,1-2H3/b8-6+.
What are the key properties of N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine?
N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine has a molecular weight of 169.25 g/mol, XLogP of 1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(1,2,4-thiadiazol-5-yl)butan-2-imine is sourced from PubChem (CID 123621328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).