About 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol
1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol (PubChem CID 123621509) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol |
| PubChem CID | 123621509 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol |
| SMILES | CC=CC(=CC)c1nc(C(C)O)no1 |
| InChI | InChI=1S/C10H14N2O2/c1-4-6-8(5-2)10-11-9(7(3)13)12-14-10/h4-7,13H,1-3H3 |
| InChIKey | PKOGYDNLDGKCKR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol?
The IUPAC name of 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol (CID 123621509) is 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol.
What is the SMILES notation for 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol?
The canonical SMILES for 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol is CC=CC(=CC)c1nc(C(C)O)no1.
What is the InChIKey of 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol?
The InChIKey is PKOGYDNLDGKCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-4-6-8(5-2)10-11-9(7(3)13)12-14-10/h4-7,13H,1-3H3.
What are the key properties of 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol?
1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol has a molecular weight of 194.23 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-hexa-2,4-dien-3-yl-1,2,4-oxadiazol-3-yl)ethanol is sourced from PubChem (CID 123621509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).