C33H43F3N2OS — CID 123622069
1-[5-(8,9-dihydro-7H-cyclohepta[d]pyrimidin-4-ylmethyl)cyclooctyl]-8-[3-(trifluoromethylsulfanyl)phenyl]octan-4-one (PubChem CID 123622069) has the molecular formula C33H43F3N2OS and a molecular weight of 572.78 g/mol. Its IUPAC name is 1-[5-(8,9-dihydro-7H-cyclohepta[d]pyrimidin-4-ylmethyl)cyclooctyl]-8-[3-(trifluoromethylsulfanyl)phenyl]octan-4-one.
| Compound Name | 1-[5-(8,9-dihydro-7H-cyclohepta[d]pyrimidin-4-ylmethyl)cyclooctyl]-8-[3-(trifluoromethylsulfanyl)phenyl]octan-4-one |
|---|---|
| PubChem CID | 123622069 |
| Molecular Formula | C33H43F3N2OS |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 1-[5-(8,9-dihydro-7H-cyclohepta[d]pyrimidin-4-ylmethyl)cyclooctyl]-8-[3-(trifluoromethylsulfanyl)phenyl]octan-4-one |
| SMILES | O=C(CCCCc1cccc(SC(F)(F)F)c1)CCCC1CCCC(Cc2ncnc3c2C=CCCC3)CCC1 |
| InChI | InChI=1S/C33H43F3N2OS/c34-33(35,36)40-29-19-9-16-26(22-29)10-4-5-17-28(39)18-8-13-25-11-6-14-27(15-7-12-25)23-32-30-20-2-1-3-21-31(30)37-24-38-32/h2,9,16,19-20,22,24-25,27H,1,3-8,10-15,17-18,21,23H2 |
| InChIKey | SYNOICREBNGDLM-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|