C19H21FO6 — CID 123622178
ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 123622178) has the molecular formula C19H21FO6 and a molecular weight of 364.37 g/mol. Its IUPAC name is ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123622178 |
| Molecular Formula | C19H21FO6 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl 2-[[(2R,6S)-6-(acetyloxymethyl)-3,6-dihydro-2H-pyran-2-yl]oxy]-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1ccccc1F)O[C@@H]1CC=C[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C19H21FO6/c1-3-23-19(22)17(11-14-7-4-5-9-16(14)20)26-18-10-6-8-15(25-18)12-24-13(2)21/h4-9,11,15,18H,3,10,12H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | IIFMPCQVXUWCIW-MAUKXSAKSA-N |
| XLogP | 2.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|