About (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid
(3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid (PubChem CID 123622206) has the molecular formula C6H9BFNO2
and a molecular weight of 156.95 g/mol. Its IUPAC name is (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid.
Molecular Properties
| Compound Name | (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid |
| PubChem CID | 123622206 |
| Molecular Formula | C6H9BFNO2 |
| Molecular Weight | 156.95 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid |
| SMILES | CC1C(B(O)O)=CN=CC1F |
| InChI | InChI=1S/C6H9BFNO2/c1-4-5(7(10)11)2-9-3-6(4)8/h2-4,6,10-11H,1H3 |
| InChIKey | JNPOBBVHDWGQIT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.95 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid?
The IUPAC name of (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid (CID 123622206) is (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid.
What is the SMILES notation for (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid?
The canonical SMILES for (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid is CC1C(B(O)O)=CN=CC1F.
What is the InChIKey of (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid?
The InChIKey is JNPOBBVHDWGQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BFNO2/c1-4-5(7(10)11)2-9-3-6(4)8/h2-4,6,10-11H,1H3.
What are the key properties of (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid?
(3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid has a molecular weight of 156.95 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4-methyl-3,4-dihydropyridin-5-yl)boronic acid is sourced from PubChem (CID 123622206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).