C13H7Cl6N3O2S — CID 123622440
[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methylsulfanylformic acid (PubChem CID 123622440) has the molecular formula C13H7Cl6N3O2S and a molecular weight of 482.00 g/mol. Its IUPAC name is [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methylsulfanylformic acid.
| Compound Name | [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methylsulfanylformic acid |
|---|---|
| PubChem CID | 123622440 |
| Molecular Formula | C13H7Cl6N3O2S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 478.84 |
| IUPAC Name | [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methylsulfanylformic acid |
| SMILES | O=C(O)SCc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C13H7Cl6N3O2S/c14-12(15,16)9-20-8(21-10(22-9)13(17,18)19)7-3-1-6(2-4-7)5-25-11(23)24/h1-4H,5H2,(H,23,24) |
| InChIKey | STFMXVMWMPAZAK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|