About N-propyl-N-(2H-1,3-thiazol-3-yl)formamide
N-propyl-N-(2H-1,3-thiazol-3-yl)formamide (PubChem CID 123622573) has the molecular formula C7H12N2OS
and a molecular weight of 172.25 g/mol. Its IUPAC name is N-propyl-N-(2H-1,3-thiazol-3-yl)formamide.
Molecular Properties
| Compound Name | N-propyl-N-(2H-1,3-thiazol-3-yl)formamide |
| PubChem CID | 123622573 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | N-propyl-N-(2H-1,3-thiazol-3-yl)formamide |
| SMILES | CCCN(C=O)N1C=CSC1 |
| InChI | InChI=1S/C7H12N2OS/c1-2-3-8(6-10)9-4-5-11-7-9/h4-6H,2-3,7H2,1H3 |
| InChIKey | VBPOVWPPAAPKKV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-N-(2H-1,3-thiazol-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-N-(2H-1,3-thiazol-3-yl)formamide?
The IUPAC name of N-propyl-N-(2H-1,3-thiazol-3-yl)formamide (CID 123622573) is N-propyl-N-(2H-1,3-thiazol-3-yl)formamide.
What is the SMILES notation for N-propyl-N-(2H-1,3-thiazol-3-yl)formamide?
The canonical SMILES for N-propyl-N-(2H-1,3-thiazol-3-yl)formamide is CCCN(C=O)N1C=CSC1.
What is the InChIKey of N-propyl-N-(2H-1,3-thiazol-3-yl)formamide?
The InChIKey is VBPOVWPPAAPKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS/c1-2-3-8(6-10)9-4-5-11-7-9/h4-6H,2-3,7H2,1H3.
What are the key properties of N-propyl-N-(2H-1,3-thiazol-3-yl)formamide?
N-propyl-N-(2H-1,3-thiazol-3-yl)formamide has a molecular weight of 172.25 g/mol, XLogP of 1.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-N-(2H-1,3-thiazol-3-yl)formamide is sourced from PubChem (CID 123622573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).