About 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide
2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide (PubChem CID 123622647) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide |
| PubChem CID | 123622647 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide |
| SMILES | C=CC=C(C=C)N(C)C(=O)CC1CCCC1 |
| InChI | InChI=1S/C14H21NO/c1-4-8-13(5-2)15(3)14(16)11-12-9-6-7-10-12/h4-5,8,12H,1-2,6-7,9-11H2,3H3 |
| InChIKey | CWKOQRHCTIVYMD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide?
The IUPAC name of 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide (CID 123622647) is 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide.
What is the SMILES notation for 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide?
The canonical SMILES for 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide is C=CC=C(C=C)N(C)C(=O)CC1CCCC1.
What is the InChIKey of 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide?
The InChIKey is CWKOQRHCTIVYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-4-8-13(5-2)15(3)14(16)11-12-9-6-7-10-12/h4-5,8,12H,1-2,6-7,9-11H2,3H3.
What are the key properties of 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide?
2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide has a molecular weight of 219.33 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-hexa-1,3,5-trien-3-yl-N-methylacetamide is sourced from PubChem (CID 123622647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).