About [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate
[ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate (PubChem CID 123622969) has the molecular formula C11H16N4O2
and a molecular weight of 236.28 g/mol. Its IUPAC name is [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate.
Molecular Properties
| Compound Name | [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate |
| PubChem CID | 123622969 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate |
| SMILES | CC(=NN)OC(OC(C)=NN)c1ccccc1 |
| InChI | InChI=1S/C11H16N4O2/c1-8(14-12)16-11(17-9(2)15-13)10-6-4-3-5-7-10/h3-7,11H,12-13H2,1-2H3 |
| InChIKey | DLGWVVMUTUIROY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate?
The IUPAC name of [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate (CID 123622969) is [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate.
What is the SMILES notation for [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate?
The canonical SMILES for [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate is CC(=NN)OC(OC(C)=NN)c1ccccc1.
What is the InChIKey of [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate?
The InChIKey is DLGWVVMUTUIROY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2/c1-8(14-12)16-11(17-9(2)15-13)10-6-4-3-5-7-10/h3-7,11H,12-13H2,1-2H3.
What are the key properties of [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate?
[ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate has a molecular weight of 236.28 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [ethanehydrazonoyloxy(phenyl)methyl] ethanehydrazonate is sourced from PubChem (CID 123622969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).