About ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane
ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane (PubChem CID 123622984) has the molecular formula C10H30OSi2
and a molecular weight of 222.52 g/mol. Its IUPAC name is ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane.
Molecular Properties
| Compound Name | ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane |
| PubChem CID | 123622984 |
| Molecular Formula | C10H30OSi2 |
| Molecular Weight | 222.52 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane |
| SMILES | CCC.CC[SiH2]C.COCC[SiH2]C |
| InChI | InChI=1S/C4H12OSi.C3H10Si.C3H8/c1-5-3-4-6-2;1-3-4-2;1-3-2/h3-4,6H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | QEZORJVHNWJVPP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane?
The IUPAC name of ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane (CID 123622984) is ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane.
What is the SMILES notation for ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane?
The canonical SMILES for ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane is CCC.CC[SiH2]C.COCC[SiH2]C.
What is the InChIKey of ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane?
The InChIKey is QEZORJVHNWJVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.C3H10Si.C3H8/c1-5-3-4-6-2;1-3-4-2;1-3-2/h3-4,6H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane?
ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane has a molecular weight of 222.52 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(methyl)silane;2-methoxyethyl(methyl)silane;propane is sourced from PubChem (CID 123622984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).